C27H21ClF3NO3 — CID 75596816
3-[[5-chloro-3-[2-methyl-1-[4-(trifluoromethyl)phenyl]propylidene]-2-oxoindol-1-yl]methyl]benzoic acid (PubChem CID 75596816) has the molecular formula C27H21ClF3NO3 and a molecular weight of 499.92 g/mol. Its IUPAC name is 3-[[5-chloro-3-[2-methyl-1-[4-(trifluoromethyl)phenyl]propylidene]-2-oxoindol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[5-chloro-3-[2-methyl-1-[4-(trifluoromethyl)phenyl]propylidene]-2-oxoindol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 75596816 |
| Molecular Formula | C27H21ClF3NO3 |
| Molecular Weight | 499.92 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 3-[[5-chloro-3-[2-methyl-1-[4-(trifluoromethyl)phenyl]propylidene]-2-oxoindol-1-yl]methyl]benzoic acid |
| SMILES | CC(C)C(=C1C(=O)N(Cc2cccc(C(=O)O)c2)c2ccc(Cl)cc21)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H21ClF3NO3/c1-15(2)23(17-6-8-19(9-7-17)27(29,30)31)24-21-13-20(28)10-11-22(21)32(25(24)33)14-16-4-3-5-18(12-16)26(34)35/h3-13,15H,14H2,1-2H3,(H,34,35) |
| InChIKey | KNDAOTNDLZLQLJ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.92 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|