C18H13BrF3NO2 — CID 171842263
methyl 3-[[7-bromo-5-(trifluoromethyl)indol-1-yl]methyl]benzoate (PubChem CID 171842263) has the molecular formula C18H13BrF3NO2 and a molecular weight of 412.21 g/mol. Its IUPAC name is methyl 3-[[7-bromo-5-(trifluoromethyl)indol-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[7-bromo-5-(trifluoromethyl)indol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 171842263 |
| Molecular Formula | C18H13BrF3NO2 |
| Molecular Weight | 412.21 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | methyl 3-[[7-bromo-5-(trifluoromethyl)indol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(Cn2ccc3cc(C(F)(F)F)cc(Br)c32)c1 |
| InChI | InChI=1S/C18H13BrF3NO2/c1-25-17(24)13-4-2-3-11(7-13)10-23-6-5-12-8-14(18(20,21)22)9-15(19)16(12)23/h2-9H,10H2,1H3 |
| InChIKey | WLCVRDMKMPJZJC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.21 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |