methyl 3-[(4,6-dimethoxyindol-1-yl)methyl]benzoate

C19H19NO4 — CID 110831380

IUPACmethyl 3-[(4,6-dimethoxyindol-1-yl)methyl]benzoate
SMILESCOC(=O)c1cccc(Cn2ccc3c(OC)cc(OC)cc32)c1
InChIInChI=1S/C19H19NO4/c1-22-15-10-17-16(18(11-15)23-2)7-8-20(17)12-13-5-4-6-14(9-13)19(21)24-3/h4-11H,12H2,1-3H3
InChIKeyBGULRURDOPSCEG-UHFFFAOYSA-N
MW325.36 g/mol
LogP3.49
Rot. Bonds5

About methyl 3-[(4,6-dimethoxyindol-1-yl)methyl]benzoate

methyl 3-[(4,6-dimethoxyindol-1-yl)methyl]benzoate (PubChem CID 110831380) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is methyl 3-[(4,6-dimethoxyindol-1-yl)methyl]benzoate.

Molecular Properties

Compound Namemethyl 3-[(4,6-dimethoxyindol-1-yl)methyl]benzoate
PubChem CID110831380
Molecular FormulaC19H19NO4
Molecular Weight325.36 g/mol
Exact Mass325.13
IUPAC Namemethyl 3-[(4,6-dimethoxyindol-1-yl)methyl]benzoate
SMILESCOC(=O)c1cccc(Cn2ccc3c(OC)cc(OC)cc32)c1
InChIInChI=1S/C19H19NO4/c1-22-15-10-17-16(18(11-15)23-2)7-8-20(17)12-13-5-4-6-14(9-13)19(21)24-3/h4-11H,12H2,1-3H3
InChIKeyBGULRURDOPSCEG-UHFFFAOYSA-N
XLogP3.49
TPSA49.69 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.36
LogP ≤ 53.49
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 3-[(4,6-dimethoxyindol-1-yl)methyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(4,6-dimethoxyindol-1-yl)methyl]benzoate?
The IUPAC name of methyl 3-[(4,6-dimethoxyindol-1-yl)methyl]benzoate (CID 110831380) is methyl 3-[(4,6-dimethoxyindol-1-yl)methyl]benzoate.
What is the SMILES notation for methyl 3-[(4,6-dimethoxyindol-1-yl)methyl]benzoate?
The canonical SMILES for methyl 3-[(4,6-dimethoxyindol-1-yl)methyl]benzoate is COC(=O)c1cccc(Cn2ccc3c(OC)cc(OC)cc32)c1.
What is the InChIKey of methyl 3-[(4,6-dimethoxyindol-1-yl)methyl]benzoate?
The InChIKey is BGULRURDOPSCEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO4/c1-22-15-10-17-16(18(11-15)23-2)7-8-20(17)12-13-5-4-6-14(9-13)19(21)24-3/h4-11H,12H2,1-3H3.
What are the key properties of methyl 3-[(4,6-dimethoxyindol-1-yl)methyl]benzoate?
methyl 3-[(4,6-dimethoxyindol-1-yl)methyl]benzoate has a molecular weight of 325.36 g/mol, XLogP of 3.49, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(4,6-dimethoxyindol-1-yl)methyl]benzoate is sourced from PubChem (CID 110831380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).