C10H8I2O5 — CID 130328658
bis(iodomethyl) 5-hydroxybenzene-1,3-dicarboxylate (PubChem CID 130328658) has the molecular formula C10H8I2O5 and a molecular weight of 461.98 g/mol. Its IUPAC name is bis(iodomethyl) 5-hydroxybenzene-1,3-dicarboxylate.
| Compound Name | bis(iodomethyl) 5-hydroxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 130328658 |
| Molecular Formula | C10H8I2O5 |
| Molecular Weight | 461.98 g/mol |
| Exact Mass | 461.85 |
| IUPAC Name | bis(iodomethyl) 5-hydroxybenzene-1,3-dicarboxylate |
| SMILES | O=C(OCI)c1cc(O)cc(C(=O)OCI)c1 |
| InChI | InChI=1S/C10H8I2O5/c11-4-16-9(14)6-1-7(3-8(13)2-6)10(15)17-5-12/h1-3,13H,4-5H2 |
| InChIKey | LQNPFZREFKKBFY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.98 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|