C13H18F2N4O — CID 63185956
(3,5-difluoro-4-hydrazinylphenyl)-(4-methyl-1,4-diazepan-1-yl)methanone (PubChem CID 63185956) has the molecular formula C13H18F2N4O and a molecular weight of 284.31 g/mol. Its IUPAC name is (3,5-difluoro-4-hydrazinylphenyl)-(4-methyl-1,4-diazepan-1-yl)methanone.
| Compound Name | (3,5-difluoro-4-hydrazinylphenyl)-(4-methyl-1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 63185956 |
| Molecular Formula | C13H18F2N4O |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (3,5-difluoro-4-hydrazinylphenyl)-(4-methyl-1,4-diazepan-1-yl)methanone |
| SMILES | CN1CCCN(C(=O)c2cc(F)c(NN)c(F)c2)CC1 |
| InChI | InChI=1S/C13H18F2N4O/c1-18-3-2-4-19(6-5-18)13(20)9-7-10(14)12(17-16)11(15)8-9/h7-8,17H,2-6,16H2,1H3 |
| InChIKey | OOJHWEBHUMHSFK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|