C14H20F2N4O — CID 63186501
(3,5-difluoro-4-hydrazinylphenyl)-(4-propylpiperazin-1-yl)methanone (PubChem CID 63186501) has the molecular formula C14H20F2N4O and a molecular weight of 298.34 g/mol. Its IUPAC name is (3,5-difluoro-4-hydrazinylphenyl)-(4-propylpiperazin-1-yl)methanone.
| Compound Name | (3,5-difluoro-4-hydrazinylphenyl)-(4-propylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 63186501 |
| Molecular Formula | C14H20F2N4O |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (3,5-difluoro-4-hydrazinylphenyl)-(4-propylpiperazin-1-yl)methanone |
| SMILES | CCCN1CCN(C(=O)c2cc(F)c(NN)c(F)c2)CC1 |
| InChI | InChI=1S/C14H20F2N4O/c1-2-3-19-4-6-20(7-5-19)14(21)10-8-11(15)13(18-17)12(16)9-10/h8-9,18H,2-7,17H2,1H3 |
| InChIKey | MYELXOJTGTVNOO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|