C17H24F2N2O — CID 138385310
[4-(5-fluoropentyl)-1,4-diazepan-1-yl]-(4-fluorophenyl)methanone (PubChem CID 138385310) has the molecular formula C17H24F2N2O and a molecular weight of 310.39 g/mol. Its IUPAC name is [4-(5-fluoropentyl)-1,4-diazepan-1-yl]-(4-fluorophenyl)methanone.
| Compound Name | [4-(5-fluoropentyl)-1,4-diazepan-1-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 138385310 |
| Molecular Formula | C17H24F2N2O |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | [4-(5-fluoropentyl)-1,4-diazepan-1-yl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCCN(CCCCCF)CC1 |
| InChI | InChI=1S/C17H24F2N2O/c18-9-2-1-3-10-20-11-4-12-21(14-13-20)17(22)15-5-7-16(19)8-6-15/h5-8H,1-4,9-14H2 |
| InChIKey | QSJHOTXFQAXBPL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|