C20H27FN4O — CID 137339403
[4-(5-fluoropentyl)-1,4-diazepan-1-yl]-(2-pyrazol-1-ylphenyl)methanone (PubChem CID 137339403) has the molecular formula C20H27FN4O and a molecular weight of 358.46 g/mol. Its IUPAC name is [4-(5-fluoropentyl)-1,4-diazepan-1-yl]-(2-pyrazol-1-ylphenyl)methanone.
| Compound Name | [4-(5-fluoropentyl)-1,4-diazepan-1-yl]-(2-pyrazol-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 137339403 |
| Molecular Formula | C20H27FN4O |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | [4-(5-fluoropentyl)-1,4-diazepan-1-yl]-(2-pyrazol-1-ylphenyl)methanone |
| SMILES | O=C(c1ccccc1-n1cccn1)N1CCCN(CCCCCF)CC1 |
| InChI | InChI=1S/C20H27FN4O/c21-10-4-1-5-12-23-13-7-14-24(17-16-23)20(26)18-8-2-3-9-19(18)25-15-6-11-22-25/h2-3,6,8-9,11,15H,1,4-5,7,10,12-14,16-17H2 |
| InChIKey | KMDHEZOCTVOTGW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|