C19H23N5O — CID 137340536
[4-(2-imidazol-1-ylethyl)-1,4-diazepan-1-yl]-(1H-indol-3-yl)methanone (PubChem CID 137340536) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is [4-(2-imidazol-1-ylethyl)-1,4-diazepan-1-yl]-(1H-indol-3-yl)methanone.
| Compound Name | [4-(2-imidazol-1-ylethyl)-1,4-diazepan-1-yl]-(1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 137340536 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | [4-(2-imidazol-1-ylethyl)-1,4-diazepan-1-yl]-(1H-indol-3-yl)methanone |
| SMILES | O=C(c1c[nH]c2ccccc12)N1CCCN(CCn2ccnc2)CC1 |
| InChI | InChI=1S/C19H23N5O/c25-19(17-14-21-18-5-2-1-4-16(17)18)24-8-3-7-22(12-13-24)10-11-23-9-6-20-15-23/h1-2,4-6,9,14-15,21H,3,7-8,10-13H2 |
| InChIKey | SYUWULRDLKFZAQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 57.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |