C11H15ClN4OS — CID 62242607
(2-chloro-6-hydrazinyl-4-pyridinyl)-(1,4-thiazepan-4-yl)methanone (PubChem CID 62242607) has the molecular formula C11H15ClN4OS and a molecular weight of 286.79 g/mol. Its IUPAC name is (2-chloro-6-hydrazinyl-4-pyridinyl)-(1,4-thiazepan-4-yl)methanone.
| Compound Name | (2-chloro-6-hydrazinyl-4-pyridinyl)-(1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 62242607 |
| Molecular Formula | C11H15ClN4OS |
| Molecular Weight | 286.79 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | (2-chloro-6-hydrazinyl-4-pyridinyl)-(1,4-thiazepan-4-yl)methanone |
| SMILES | NNc1cc(C(=O)N2CCCSCC2)cc(Cl)n1 |
| InChI | InChI=1S/C11H15ClN4OS/c12-9-6-8(7-10(14-9)15-13)11(17)16-2-1-4-18-5-3-16/h6-7H,1-5,13H2,(H,14,15) |
| InChIKey | WVGSYENOZAKXSF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.79 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|