C14H21ClN4O — CID 65286839
(2-chloro-6-hydrazinyl-4-pyridinyl)-(4,4-dimethylazepan-1-yl)methanone (PubChem CID 65286839) has the molecular formula C14H21ClN4O and a molecular weight of 296.80 g/mol. Its IUPAC name is (2-chloro-6-hydrazinyl-4-pyridinyl)-(4,4-dimethylazepan-1-yl)methanone.
| Compound Name | (2-chloro-6-hydrazinyl-4-pyridinyl)-(4,4-dimethylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 65286839 |
| Molecular Formula | C14H21ClN4O |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (2-chloro-6-hydrazinyl-4-pyridinyl)-(4,4-dimethylazepan-1-yl)methanone |
| SMILES | CC1(C)CCCN(C(=O)c2cc(Cl)nc(NN)c2)CC1 |
| InChI | InChI=1S/C14H21ClN4O/c1-14(2)4-3-6-19(7-5-14)13(20)10-8-11(15)17-12(9-10)18-16/h8-9H,3-7,16H2,1-2H3,(H,17,18) |
| InChIKey | SWNLWGMAXQJNCH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|