C10H12ClN3O — CID 62156377
(2-amino-6-chloro-4-pyridinyl)-pyrrolidin-1-ylmethanone (PubChem CID 62156377) has the molecular formula C10H12ClN3O and a molecular weight of 225.68 g/mol. Its IUPAC name is (2-amino-6-chloro-4-pyridinyl)-pyrrolidin-1-ylmethanone.
| Compound Name | (2-amino-6-chloro-4-pyridinyl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 62156377 |
| Molecular Formula | C10H12ClN3O |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | (2-amino-6-chloro-4-pyridinyl)-pyrrolidin-1-ylmethanone |
| SMILES | Nc1cc(C(=O)N2CCCC2)cc(Cl)n1 |
| InChI | InChI=1S/C10H12ClN3O/c11-8-5-7(6-9(12)13-8)10(15)14-3-1-2-4-14/h5-6H,1-4H2,(H2,12,13) |
| InChIKey | DLRMJXPVANWKMT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|