C14H16N2O3 — CID 77066399
4-[3-(4-hydroxyphenyl)prop-2-enoyl]-1,4-diazepan-2-one (PubChem CID 77066399) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-[3-(4-hydroxyphenyl)prop-2-enoyl]-1,4-diazepan-2-one.
| Compound Name | 4-[3-(4-hydroxyphenyl)prop-2-enoyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 77066399 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4-[3-(4-hydroxyphenyl)prop-2-enoyl]-1,4-diazepan-2-one |
| SMILES | O=C1CN(C(=O)C=Cc2ccc(O)cc2)CCCN1 |
| InChI | InChI=1S/C14H16N2O3/c17-12-5-2-11(3-6-12)4-7-14(19)16-9-1-8-15-13(18)10-16/h2-7,17H,1,8-10H2,(H,15,18) |
| InChIKey | DWTPVYIIOUCLSS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|