C13H12Cl2N2O2 — CID 74607633
4-[3-(2,3-dichlorophenyl)prop-2-enoyl]piperazin-2-one (PubChem CID 74607633) has the molecular formula C13H12Cl2N2O2 and a molecular weight of 299.16 g/mol. Its IUPAC name is 4-[3-(2,3-dichlorophenyl)prop-2-enoyl]piperazin-2-one.
| Compound Name | 4-[3-(2,3-dichlorophenyl)prop-2-enoyl]piperazin-2-one |
|---|---|
| PubChem CID | 74607633 |
| Molecular Formula | C13H12Cl2N2O2 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 4-[3-(2,3-dichlorophenyl)prop-2-enoyl]piperazin-2-one |
| SMILES | O=C1CN(C(=O)C=Cc2cccc(Cl)c2Cl)CCN1 |
| InChI | InChI=1S/C13H12Cl2N2O2/c14-10-3-1-2-9(13(10)15)4-5-12(19)17-7-6-16-11(18)8-17/h1-5H,6-8H2,(H,16,18) |
| InChIKey | RCRZVMZIINMDRZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|