C14H14ClFN2O2 — CID 76976791
4-[3-(3-chloro-4-fluorophenyl)prop-2-enoyl]-1,4-diazepan-2-one (PubChem CID 76976791) has the molecular formula C14H14ClFN2O2 and a molecular weight of 296.73 g/mol. Its IUPAC name is 4-[3-(3-chloro-4-fluorophenyl)prop-2-enoyl]-1,4-diazepan-2-one.
| Compound Name | 4-[3-(3-chloro-4-fluorophenyl)prop-2-enoyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 76976791 |
| Molecular Formula | C14H14ClFN2O2 |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-[3-(3-chloro-4-fluorophenyl)prop-2-enoyl]-1,4-diazepan-2-one |
| SMILES | O=C1CN(C(=O)C=Cc2ccc(F)c(Cl)c2)CCCN1 |
| InChI | InChI=1S/C14H14ClFN2O2/c15-11-8-10(2-4-12(11)16)3-5-14(20)18-7-1-6-17-13(19)9-18/h2-5,8H,1,6-7,9H2,(H,17,19) |
| InChIKey | KAOLFDWKMOKRGQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|