C14H15FN2O2 — CID 76976459
4-[3-(3-fluorophenyl)prop-2-enoyl]-1,4-diazepan-2-one (PubChem CID 76976459) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is 4-[3-(3-fluorophenyl)prop-2-enoyl]-1,4-diazepan-2-one.
| Compound Name | 4-[3-(3-fluorophenyl)prop-2-enoyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 76976459 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-[3-(3-fluorophenyl)prop-2-enoyl]-1,4-diazepan-2-one |
| SMILES | O=C1CN(C(=O)C=Cc2cccc(F)c2)CCCN1 |
| InChI | InChI=1S/C14H15FN2O2/c15-12-4-1-3-11(9-12)5-6-14(19)17-8-2-7-16-13(18)10-17/h1,3-6,9H,2,7-8,10H2,(H,16,18) |
| InChIKey | WKIHPTRSUKEFQQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|