C14H16FN3O3 — CID 62895950
3-fluoro-N-[2-oxo-2-(3-oxo-1,4-diazepan-1-yl)ethyl]benzamide (PubChem CID 62895950) has the molecular formula C14H16FN3O3 and a molecular weight of 293.30 g/mol. Its IUPAC name is 3-fluoro-N-[2-oxo-2-(3-oxo-1,4-diazepan-1-yl)ethyl]benzamide.
| Compound Name | 3-fluoro-N-[2-oxo-2-(3-oxo-1,4-diazepan-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 62895950 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3-fluoro-N-[2-oxo-2-(3-oxo-1,4-diazepan-1-yl)ethyl]benzamide |
| SMILES | O=C1CN(C(=O)CNC(=O)c2cccc(F)c2)CCCN1 |
| InChI | InChI=1S/C14H16FN3O3/c15-11-4-1-3-10(7-11)14(21)17-8-13(20)18-6-2-5-16-12(19)9-18/h1,3-4,7H,2,5-6,8-9H2,(H,16,19)(H,17,21) |
| InChIKey | OIZWWRMWUHZVLT-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |