C14H16ClN3O3 — CID 64722179
4-chloro-N-[2-oxo-2-(3-oxo-1,4-diazepan-1-yl)ethyl]benzamide (PubChem CID 64722179) has the molecular formula C14H16ClN3O3 and a molecular weight of 309.75 g/mol. Its IUPAC name is 4-chloro-N-[2-oxo-2-(3-oxo-1,4-diazepan-1-yl)ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-oxo-2-(3-oxo-1,4-diazepan-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 64722179 |
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 4-chloro-N-[2-oxo-2-(3-oxo-1,4-diazepan-1-yl)ethyl]benzamide |
| SMILES | O=C1CN(C(=O)CNC(=O)c2ccc(Cl)cc2)CCCN1 |
| InChI | InChI=1S/C14H16ClN3O3/c15-11-4-2-10(3-5-11)14(21)17-8-13(20)18-7-1-6-16-12(19)9-18/h2-5H,1,6-9H2,(H,16,19)(H,17,21) |
| InChIKey | WSURHASQSXFQPL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |