C20H17Cl3FN3O2 — CID 44529380
N-(3-chloro-4-fluorophenyl)-4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]piperazine-1-carboxamide (PubChem CID 44529380) has the molecular formula C20H17Cl3FN3O2 and a molecular weight of 456.73 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]piperazine-1-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 44529380 |
| Molecular Formula | C20H17Cl3FN3O2 |
| Molecular Weight | 456.73 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]piperazine-1-carboxamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)N1CCN(C(=O)Nc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H17Cl3FN3O2/c21-15-4-1-13(11-16(15)22)2-6-19(28)26-7-9-27(10-8-26)20(29)25-14-3-5-18(24)17(23)12-14/h1-6,11-12H,7-10H2,(H,25,29)/b6-2+ |
| InChIKey | JUALGPOGKIFYGB-QHHAFSJGSA-N |
| XLogP | 5.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.73 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|