C17H24ClFN3O+ — CID 7364521
N-(3-chloro-4-fluorophenyl)-4-cyclohexylpiperazin-4-ium-1-carboxamide (PubChem CID 7364521) has the molecular formula C17H24ClFN3O+ and a molecular weight of 340.85 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-cyclohexylpiperazin-4-ium-1-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-cyclohexylpiperazin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 7364521 |
| Molecular Formula | C17H24ClFN3O+ |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-cyclohexylpiperazin-4-ium-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)N1CC[NH+](C2CCCCC2)CC1 |
| InChI | InChI=1S/C17H23ClFN3O/c18-15-12-13(6-7-16(15)19)20-17(23)22-10-8-21(9-11-22)14-4-2-1-3-5-14/h6-7,12,14H,1-5,8-11H2,(H,20,23)/p+1 |
| InChIKey | CUYNPZBFBXHDOQ-UHFFFAOYSA-O |
| XLogP | 2.54 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |