C18H27ClN3O+ — CID 7345960
N-(3-chloro-2-methylphenyl)-4-cyclohexylpiperazin-4-ium-1-carboxamide (PubChem CID 7345960) has the molecular formula C18H27ClN3O+ and a molecular weight of 336.89 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-4-cyclohexylpiperazin-4-ium-1-carboxamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-4-cyclohexylpiperazin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 7345960 |
| Molecular Formula | C18H27ClN3O+ |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-4-cyclohexylpiperazin-4-ium-1-carboxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)N1CC[NH+](C2CCCCC2)CC1 |
| InChI | InChI=1S/C18H26ClN3O/c1-14-16(19)8-5-9-17(14)20-18(23)22-12-10-21(11-13-22)15-6-3-2-4-7-15/h5,8-9,15H,2-4,6-7,10-13H2,1H3,(H,20,23)/p+1 |
| InChIKey | WZBIBCPXHOHVLA-UHFFFAOYSA-O |
| XLogP | 2.71 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |