C15H16Cl2N2O2 — CID 77000404
4-[3-(2,3-dichlorophenyl)prop-2-enoyl]-3-ethylpiperazin-2-one (PubChem CID 77000404) has the molecular formula C15H16Cl2N2O2 and a molecular weight of 327.21 g/mol. Its IUPAC name is 4-[3-(2,3-dichlorophenyl)prop-2-enoyl]-3-ethylpiperazin-2-one.
| Compound Name | 4-[3-(2,3-dichlorophenyl)prop-2-enoyl]-3-ethylpiperazin-2-one |
|---|---|
| PubChem CID | 77000404 |
| Molecular Formula | C15H16Cl2N2O2 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 4-[3-(2,3-dichlorophenyl)prop-2-enoyl]-3-ethylpiperazin-2-one |
| SMILES | CCC1C(=O)NCCN1C(=O)C=Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H16Cl2N2O2/c1-2-12-15(21)18-8-9-19(12)13(20)7-6-10-4-3-5-11(16)14(10)17/h3-7,12H,2,8-9H2,1H3,(H,18,21) |
| InChIKey | LZIANEGQOTWZHB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|