C18H19NO4 — CID 161345511
5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;pyrrolidin-2-one (PubChem CID 161345511) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;pyrrolidin-2-one.
| Compound Name | 5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;pyrrolidin-2-one |
|---|---|
| PubChem CID | 161345511 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;pyrrolidin-2-one |
| SMILES | O=C1CCCN1.Oc1ccc(C=Cc2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C14H12O3.C4H7NO/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11;6-4-2-1-3-5-4/h1-9,15-17H;1-3H2,(H,5,6) |
| InChIKey | VNFVYVICSKEZKE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|