C15H22ClF3N2 — CID 120834617
[1-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]methanamine;hydrochloride (PubChem CID 120834617) has the molecular formula C15H22ClF3N2 and a molecular weight of 322.80 g/mol. Its IUPAC name is [1-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]methanamine;hydrochloride.
| Compound Name | [1-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120834617 |
| Molecular Formula | C15H22ClF3N2 |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [1-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]methanamine;hydrochloride |
| SMILES | Cc1cc(C(F)(F)F)ccc1CN1CCC(CN)CC1.Cl |
| InChI | InChI=1S/C15H21F3N2.ClH/c1-11-8-14(15(16,17)18)3-2-13(11)10-20-6-4-12(9-19)5-7-20;/h2-3,8,12H,4-7,9-10,19H2,1H3;1H |
| InChIKey | LKGBIJWUZHKDLB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |