C17H24F3N3O — CID 120837271
N-(2-aminoethyl)-1-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxamide (PubChem CID 120837271) has the molecular formula C17H24F3N3O and a molecular weight of 343.39 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 120837271 |
| Molecular Formula | C17H24F3N3O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-(2-aminoethyl)-1-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxamide |
| SMILES | Cc1cc(C(F)(F)F)ccc1CN1CCCC(C(=O)NCCN)C1 |
| InChI | InChI=1S/C17H24F3N3O/c1-12-9-15(17(18,19)20)5-4-13(12)10-23-8-2-3-14(11-23)16(24)22-7-6-21/h4-5,9,14H,2-3,6-8,10-11,21H2,1H3,(H,22,24) |
| InChIKey | IFOXIZCLNJLIBH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |