C15H21BrClN3O — CID 103815402
N-(2-aminoethyl)-1-[(5-bromo-2-chlorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 103815402) has the molecular formula C15H21BrClN3O and a molecular weight of 374.71 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[(5-bromo-2-chlorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[(5-bromo-2-chlorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 103815402 |
| Molecular Formula | C15H21BrClN3O |
| Molecular Weight | 374.71 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | N-(2-aminoethyl)-1-[(5-bromo-2-chlorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(Cc2cc(Br)ccc2Cl)C1 |
| InChI | InChI=1S/C15H21BrClN3O/c16-13-3-4-14(17)12(8-13)10-20-7-1-2-11(9-20)15(21)19-6-5-18/h3-4,8,11H,1-2,5-7,9-10,18H2,(H,19,21) |
| InChIKey | CQDQRWBVTHFOMZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.71 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |