C19H25F3N3O4- — CID 154023539
4-[[2-[(4-ethoxy-4-oxobutyl)amino]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 154023539) has the molecular formula C19H25F3N3O4- and a molecular weight of 416.42 g/mol. Its IUPAC name is 4-[[2-[(4-ethoxy-4-oxobutyl)amino]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 4-[[2-[(4-ethoxy-4-oxobutyl)amino]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 154023539 |
| Molecular Formula | C19H25F3N3O4- |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 4-[[2-[(4-ethoxy-4-oxobutyl)amino]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)CCCNc1cc(C(F)(F)F)ccc1CN1CCN(C(=O)[O-])CC1 |
| InChI | InChI=1S/C19H26F3N3O4/c1-2-29-17(26)4-3-7-23-16-12-15(19(20,21)22)6-5-14(16)13-24-8-10-25(11-9-24)18(27)28/h5-6,12,23H,2-4,7-11,13H2,1H3,(H,27,28)/p-1 |
| InChIKey | WTKGYLAMHVJHLL-UHFFFAOYSA-M |
| XLogP | 1.92 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|