C23H31F3N3O7- — CID 154023548
4-[[2-[[4-oxo-4-(1-propan-2-yloxycarbonyloxyethoxy)butyl]amino]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 154023548) has the molecular formula C23H31F3N3O7- and a molecular weight of 518.51 g/mol. Its IUPAC name is 4-[[2-[[4-oxo-4-(1-propan-2-yloxycarbonyloxyethoxy)butyl]amino]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 4-[[2-[[4-oxo-4-(1-propan-2-yloxycarbonyloxyethoxy)butyl]amino]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 154023548 |
| Molecular Formula | C23H31F3N3O7- |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 4-[[2-[[4-oxo-4-(1-propan-2-yloxycarbonyloxyethoxy)butyl]amino]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)OC(=O)OC(C)OC(=O)CCCNc1cc(C(F)(F)F)ccc1CN1CCN(C(=O)[O-])CC1 |
| InChI | InChI=1S/C23H32F3N3O7/c1-15(2)34-22(33)36-16(3)35-20(30)5-4-8-27-19-13-18(23(24,25)26)7-6-17(19)14-28-9-11-29(12-10-28)21(31)32/h6-7,13,15-16,27H,4-5,8-12,14H2,1-3H3,(H,31,32)/p-1 |
| InChIKey | YECCUHVQMZMLNP-UHFFFAOYSA-M |
| XLogP | 2.81 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|