C22H30F3N3O7 — CID 151671386
[2-[[4-(1-ethoxycarbonyloxyethoxy)-4-oxobutyl]amino]-4-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate (PubChem CID 151671386) has the molecular formula C22H30F3N3O7 and a molecular weight of 505.49 g/mol. Its IUPAC name is [2-[[4-(1-ethoxycarbonyloxyethoxy)-4-oxobutyl]amino]-4-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate.
| Compound Name | [2-[[4-(1-ethoxycarbonyloxyethoxy)-4-oxobutyl]amino]-4-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate |
|---|---|
| PubChem CID | 151671386 |
| Molecular Formula | C22H30F3N3O7 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | [2-[[4-(1-ethoxycarbonyloxyethoxy)-4-oxobutyl]amino]-4-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate |
| SMILES | CCOC(=O)OC(C)OC(=O)CCCNc1cc(C(F)(F)F)ccc1COC(=O)N1CCNCC1 |
| InChI | InChI=1S/C22H30F3N3O7/c1-3-32-21(31)35-15(2)34-19(29)5-4-8-27-18-13-17(22(23,24)25)7-6-16(18)14-33-20(30)28-11-9-26-10-12-28/h6-7,13,15,26-27H,3-5,8-12,14H2,1-2H3 |
| InChIKey | QYQAKVHGVRLXCQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|