C18H26F3N3O5S — CID 166756567
methanesulfonic acid;4-[[2-pyrrolidin-1-yl-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylic acid (PubChem CID 166756567) has the molecular formula C18H26F3N3O5S and a molecular weight of 453.48 g/mol. Its IUPAC name is methanesulfonic acid;4-[[2-pyrrolidin-1-yl-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylic acid.
| Compound Name | methanesulfonic acid;4-[[2-pyrrolidin-1-yl-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 166756567 |
| Molecular Formula | C18H26F3N3O5S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | methanesulfonic acid;4-[[2-pyrrolidin-1-yl-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylic acid |
| SMILES | CS(=O)(=O)O.O=C(O)N1CCN(Cc2ccc(C(F)(F)F)cc2N2CCCC2)CC1 |
| InChI | InChI=1S/C17H22F3N3O2.CH4O3S/c18-17(19,20)14-4-3-13(15(11-14)22-5-1-2-6-22)12-21-7-9-23(10-8-21)16(24)25;1-5(2,3)4/h3-4,11H,1-2,5-10,12H2,(H,24,25);1H3,(H,2,3,4) |
| InChIKey | YIFMKRUSCHOQPO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|