C21H24F3N3O5 — CID 174235216
(E)-4-oxo-4-[4-[[2-pyrrolidin-1-yl-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]oxybut-2-enoic acid (PubChem CID 174235216) has the molecular formula C21H24F3N3O5 and a molecular weight of 455.43 g/mol. Its IUPAC name is (E)-4-oxo-4-[4-[[2-pyrrolidin-1-yl-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]oxybut-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[4-[[2-pyrrolidin-1-yl-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]oxybut-2-enoic acid |
|---|---|
| PubChem CID | 174235216 |
| Molecular Formula | C21H24F3N3O5 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | (E)-4-oxo-4-[4-[[2-pyrrolidin-1-yl-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]oxybut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)OC(=O)N1CCN(Cc2ccc(C(F)(F)F)cc2N2CCCC2)CC1 |
| InChI | InChI=1S/C21H24F3N3O5/c22-21(23,24)16-4-3-15(17(13-16)26-7-1-2-8-26)14-25-9-11-27(12-10-25)20(31)32-19(30)6-5-18(28)29/h3-6,13H,1-2,7-12,14H2,(H,28,29)/b6-5+ |
| InChIKey | JAGQLYGGVUNORS-AATRIKPKSA-N |
| XLogP | 2.73 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|