C24H30F9N3 — CID 155441008
8-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-[[2-piperidin-1-yl-4-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane (PubChem CID 155441008) has the molecular formula C24H30F9N3 and a molecular weight of 531.51 g/mol. Its IUPAC name is 8-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-[[2-piperidin-1-yl-4-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane.
| Compound Name | 8-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-[[2-piperidin-1-yl-4-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 155441008 |
| Molecular Formula | C24H30F9N3 |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | 8-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-[[2-piperidin-1-yl-4-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane |
| SMILES | FC(F)(F)c1ccc(CN2CCC3(CCN(C(C(F)(F)F)C(F)(F)F)CC3)C2)c(N2CCCCC2)c1 |
| InChI | InChI=1S/C24H30F9N3/c25-22(26,27)18-5-4-17(19(14-18)35-9-2-1-3-10-35)15-34-11-6-21(16-34)7-12-36(13-8-21)20(23(28,29)30)24(31,32)33/h4-5,14,20H,1-3,6-13,15-16H2 |
| InChIKey | BUKSLMLCCQDHDI-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |