About 1-[[3-[(2,4-dichlorophenoxy)methyl]phenyl]methyl]azetidine
1-[[3-[(2,4-dichlorophenoxy)methyl]phenyl]methyl]azetidine (PubChem CID 175987694) has the molecular formula C17H17Cl2NO
and a molecular weight of 322.24 g/mol. Its IUPAC name is 1-[[3-[(2,4-dichlorophenoxy)methyl]phenyl]methyl]azetidine.
Molecular Properties
| Compound Name | 1-[[3-[(2,4-dichlorophenoxy)methyl]phenyl]methyl]azetidine |
| PubChem CID | 175987694 |
| Molecular Formula | C17H17Cl2NO |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 1-[[3-[(2,4-dichlorophenoxy)methyl]phenyl]methyl]azetidine |
| SMILES | Clc1ccc(OCc2cccc(CN3CCC3)c2)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2NO/c18-15-5-6-17(16(19)10-15)21-12-14-4-1-3-13(9-14)11-20-7-2-8-20/h1,3-6,9-10H,2,7-8,11-12H2 |
| InChIKey | JDSHVBUSSRNQKK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[[3-[(2,4-dichlorophenoxy)methyl]phenyl]methyl]azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3-[(2,4-dichlorophenoxy)methyl]phenyl]methyl]azetidine?
The IUPAC name of 1-[[3-[(2,4-dichlorophenoxy)methyl]phenyl]methyl]azetidine (CID 175987694) is 1-[[3-[(2,4-dichlorophenoxy)methyl]phenyl]methyl]azetidine.
What is the SMILES notation for 1-[[3-[(2,4-dichlorophenoxy)methyl]phenyl]methyl]azetidine?
The canonical SMILES for 1-[[3-[(2,4-dichlorophenoxy)methyl]phenyl]methyl]azetidine is Clc1ccc(OCc2cccc(CN3CCC3)c2)c(Cl)c1.
What is the InChIKey of 1-[[3-[(2,4-dichlorophenoxy)methyl]phenyl]methyl]azetidine?
The InChIKey is JDSHVBUSSRNQKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17Cl2NO/c18-15-5-6-17(16(19)10-15)21-12-14-4-1-3-13(9-14)11-20-7-2-8-20/h1,3-6,9-10H,2,7-8,11-12H2.
What are the key properties of 1-[[3-[(2,4-dichlorophenoxy)methyl]phenyl]methyl]azetidine?
1-[[3-[(2,4-dichlorophenoxy)methyl]phenyl]methyl]azetidine has a molecular weight of 322.24 g/mol, XLogP of 4.78, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3-[(2,4-dichlorophenoxy)methyl]phenyl]methyl]azetidine is sourced from PubChem (CID 175987694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).