C10H10Cl2O4 — CID 156581424
methyl 3-(2,4-dichloro-3,5-dihydroxyphenyl)propanoate (PubChem CID 156581424) has the molecular formula C10H10Cl2O4 and a molecular weight of 265.09 g/mol. Its IUPAC name is methyl 3-(2,4-dichloro-3,5-dihydroxyphenyl)propanoate.
| Compound Name | methyl 3-(2,4-dichloro-3,5-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 156581424 |
| Molecular Formula | C10H10Cl2O4 |
| Molecular Weight | 265.09 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | methyl 3-(2,4-dichloro-3,5-dihydroxyphenyl)propanoate |
| SMILES | COC(=O)CCc1cc(O)c(Cl)c(O)c1Cl |
| InChI | InChI=1S/C10H10Cl2O4/c1-16-7(14)3-2-5-4-6(13)9(12)10(15)8(5)11/h4,13,15H,2-3H2,1H3 |
| InChIKey | LQFWUBMXEFXWHT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.09 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |