C20H33ClO4Si — CID 102453799
ethyl 2-(chloromethyl)-4-methoxy-6-tri(propan-2-yl)silyloxybenzoate (PubChem CID 102453799) has the molecular formula C20H33ClO4Si and a molecular weight of 401.02 g/mol. Its IUPAC name is ethyl 2-(chloromethyl)-4-methoxy-6-tri(propan-2-yl)silyloxybenzoate.
| Compound Name | ethyl 2-(chloromethyl)-4-methoxy-6-tri(propan-2-yl)silyloxybenzoate |
|---|---|
| PubChem CID | 102453799 |
| Molecular Formula | C20H33ClO4Si |
| Molecular Weight | 401.02 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | ethyl 2-(chloromethyl)-4-methoxy-6-tri(propan-2-yl)silyloxybenzoate |
| SMILES | CCOC(=O)c1c(CCl)cc(OC)cc1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H33ClO4Si/c1-9-24-20(22)19-16(12-21)10-17(23-8)11-18(19)25-26(13(2)3,14(4)5)15(6)7/h10-11,13-15H,9,12H2,1-8H3 |
| InChIKey | QDBOJUPHHBOANK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.02 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|