C40H56O7Si2 — CID 102013587
ethyl 2-[(S)-[tert-butyl(diphenyl)silyl]oxy-[(3S)-5-oxooxolan-3-yl]methyl]-4-methoxy-6-tri(propan-2-yl)silyloxybenzoate (PubChem CID 102013587) has the molecular formula C40H56O7Si2 and a molecular weight of 705.05 g/mol. Its IUPAC name is ethyl 2-[(S)-[tert-butyl(diphenyl)silyl]oxy-[(3S)-5-oxooxolan-3-yl]methyl]-4-methoxy-6-tri(propan-2-yl)silyloxybenzoate.
| Compound Name | ethyl 2-[(S)-[tert-butyl(diphenyl)silyl]oxy-[(3S)-5-oxooxolan-3-yl]methyl]-4-methoxy-6-tri(propan-2-yl)silyloxybenzoate |
|---|---|
| PubChem CID | 102013587 |
| Molecular Formula | C40H56O7Si2 |
| Molecular Weight | 705.05 g/mol |
| Exact Mass | 704.36 |
| IUPAC Name | ethyl 2-[(S)-[tert-butyl(diphenyl)silyl]oxy-[(3S)-5-oxooxolan-3-yl]methyl]-4-methoxy-6-tri(propan-2-yl)silyloxybenzoate |
| SMILES | CCOC(=O)c1c(O[Si](C(C)C)(C(C)C)C(C)C)cc(OC)cc1[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1COC(=O)C1 |
| InChI | InChI=1S/C40H56O7Si2/c1-12-44-39(42)37-34(24-31(43-11)25-35(37)46-48(27(2)3,28(4)5)29(6)7)38(30-23-36(41)45-26-30)47-49(40(8,9)10,32-19-15-13-16-20-32)33-21-17-14-18-22-33/h13-22,24-25,27-30,38H,12,23,26H2,1-11H3/t30-,38-/m0/s1 |
| InChIKey | XXDIGYCVCIAUSW-BFXRBFBZSA-N |
| XLogP | 8.61 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.05 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|