C12H20ClNO4 — CID 171226703
2-[(1S)-1-amino-4-hydroxybutyl]-3,5-dimethoxyphenol;hydrochloride (PubChem CID 171226703) has the molecular formula C12H20ClNO4 and a molecular weight of 277.75 g/mol. Its IUPAC name is 2-[(1S)-1-amino-4-hydroxybutyl]-3,5-dimethoxyphenol;hydrochloride.
| Compound Name | 2-[(1S)-1-amino-4-hydroxybutyl]-3,5-dimethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171226703 |
| Molecular Formula | C12H20ClNO4 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-[(1S)-1-amino-4-hydroxybutyl]-3,5-dimethoxyphenol;hydrochloride |
| SMILES | COc1cc(O)c([C@@H](N)CCCO)c(OC)c1.Cl |
| InChI | InChI=1S/C12H19NO4.ClH/c1-16-8-6-10(15)12(11(7-8)17-2)9(13)4-3-5-14;/h6-7,9,14-15H,3-5,13H2,1-2H3;1H/t9-;/m0./s1 |
| InChIKey | MSXJJYJGKDLCBH-FVGYRXGTSA-N |
| XLogP | 1.60 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|