C11H18ClNO3 — CID 171216328
2-[(1R)-1-amino-4-hydroxybutyl]-3-methoxyphenol;hydrochloride (PubChem CID 171216328) has the molecular formula C11H18ClNO3 and a molecular weight of 247.72 g/mol. Its IUPAC name is 2-[(1R)-1-amino-4-hydroxybutyl]-3-methoxyphenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-4-hydroxybutyl]-3-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171216328 |
| Molecular Formula | C11H18ClNO3 |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-[(1R)-1-amino-4-hydroxybutyl]-3-methoxyphenol;hydrochloride |
| SMILES | COc1cccc(O)c1[C@H](N)CCCO.Cl |
| InChI | InChI=1S/C11H17NO3.ClH/c1-15-10-6-2-5-9(14)11(10)8(12)4-3-7-13;/h2,5-6,8,13-14H,3-4,7,12H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | YFKSRIYKXVVKMV-DDWIOCJRSA-N |
| XLogP | 1.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|