C17H25NOS — CID 112719312
3-(4-ethoxy-2,3,6-trimethylphenyl)pentyl thiocyanate (PubChem CID 112719312) has the molecular formula C17H25NOS and a molecular weight of 291.46 g/mol. Its IUPAC name is 3-(4-ethoxy-2,3,6-trimethylphenyl)pentyl thiocyanate.
| Compound Name | 3-(4-ethoxy-2,3,6-trimethylphenyl)pentyl thiocyanate |
|---|---|
| PubChem CID | 112719312 |
| Molecular Formula | C17H25NOS |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 3-(4-ethoxy-2,3,6-trimethylphenyl)pentyl thiocyanate |
| SMILES | CCOc1cc(C)c(C(CC)CCSC#N)c(C)c1C |
| InChI | InChI=1S/C17H25NOS/c1-6-15(8-9-20-11-18)17-12(3)10-16(19-7-2)13(4)14(17)5/h10,15H,6-9H2,1-5H3 |
| InChIKey | ZSLDLOFFEOJXSR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|