C18H28O2 — CID 83939309
6-(4-methoxy-2,3,6-trimethylphenyl)octan-3-one (PubChem CID 83939309) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 6-(4-methoxy-2,3,6-trimethylphenyl)octan-3-one.
| Compound Name | 6-(4-methoxy-2,3,6-trimethylphenyl)octan-3-one |
|---|---|
| PubChem CID | 83939309 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 6-(4-methoxy-2,3,6-trimethylphenyl)octan-3-one |
| SMILES | CCC(=O)CCC(CC)c1c(C)cc(OC)c(C)c1C |
| InChI | InChI=1S/C18H28O2/c1-7-15(9-10-16(19)8-2)18-12(3)11-17(20-6)13(4)14(18)5/h11,15H,7-10H2,1-6H3 |
| InChIKey | XIDGWYVHQBOGSD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |