C16H23FO3 — CID 83922709
6-(2-fluoro-4,5-dimethoxyphenyl)octan-3-one (PubChem CID 83922709) has the molecular formula C16H23FO3 and a molecular weight of 282.36 g/mol. Its IUPAC name is 6-(2-fluoro-4,5-dimethoxyphenyl)octan-3-one.
| Compound Name | 6-(2-fluoro-4,5-dimethoxyphenyl)octan-3-one |
|---|---|
| PubChem CID | 83922709 |
| Molecular Formula | C16H23FO3 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 6-(2-fluoro-4,5-dimethoxyphenyl)octan-3-one |
| SMILES | CCC(=O)CCC(CC)c1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C16H23FO3/c1-5-11(7-8-12(18)6-2)13-9-15(19-3)16(20-4)10-14(13)17/h9-11H,5-8H2,1-4H3 |
| InChIKey | XHYNFNIFRGEDKG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |