C16H23BrO — CID 83921876
6-(2-bromo-4,5-dimethylphenyl)octan-3-one (PubChem CID 83921876) has the molecular formula C16H23BrO and a molecular weight of 311.26 g/mol. Its IUPAC name is 6-(2-bromo-4,5-dimethylphenyl)octan-3-one.
| Compound Name | 6-(2-bromo-4,5-dimethylphenyl)octan-3-one |
|---|---|
| PubChem CID | 83921876 |
| Molecular Formula | C16H23BrO |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 6-(2-bromo-4,5-dimethylphenyl)octan-3-one |
| SMILES | CCC(=O)CCC(CC)c1cc(C)c(C)cc1Br |
| InChI | InChI=1S/C16H23BrO/c1-5-13(7-8-14(18)6-2)15-9-11(3)12(4)10-16(15)17/h9-10,13H,5-8H2,1-4H3 |
| InChIKey | BYBUWUMIUNSYOH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |