C15H23FO4 — CID 83922798
5-(2-fluoro-4,5-dimethoxyphenyl)heptane-2,3-diol (PubChem CID 83922798) has the molecular formula C15H23FO4 and a molecular weight of 286.34 g/mol. Its IUPAC name is 5-(2-fluoro-4,5-dimethoxyphenyl)heptane-2,3-diol.
| Compound Name | 5-(2-fluoro-4,5-dimethoxyphenyl)heptane-2,3-diol |
|---|---|
| PubChem CID | 83922798 |
| Molecular Formula | C15H23FO4 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 5-(2-fluoro-4,5-dimethoxyphenyl)heptane-2,3-diol |
| SMILES | CCC(CC(O)C(C)O)c1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C15H23FO4/c1-5-10(6-13(18)9(2)17)11-7-14(19-3)15(20-4)8-12(11)16/h7-10,13,17-18H,5-6H2,1-4H3 |
| InChIKey | BATTYMPPALGJQE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |