C13H18BrFO2 — CID 83933935
5-(5-bromo-2-fluorophenyl)heptane-2,3-diol (PubChem CID 83933935) has the molecular formula C13H18BrFO2 and a molecular weight of 305.19 g/mol. Its IUPAC name is 5-(5-bromo-2-fluorophenyl)heptane-2,3-diol.
| Compound Name | 5-(5-bromo-2-fluorophenyl)heptane-2,3-diol |
|---|---|
| PubChem CID | 83933935 |
| Molecular Formula | C13H18BrFO2 |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 5-(5-bromo-2-fluorophenyl)heptane-2,3-diol |
| SMILES | CCC(CC(O)C(C)O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C13H18BrFO2/c1-3-9(6-13(17)8(2)16)11-7-10(14)4-5-12(11)15/h4-5,7-9,13,16-17H,3,6H2,1-2H3 |
| InChIKey | CMXAPECDMMHAAX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |