C16H22ClNOS — CID 112719172
3-(3-chloro-6-ethoxy-2,4-dimethylphenyl)pentyl thiocyanate (PubChem CID 112719172) has the molecular formula C16H22ClNOS and a molecular weight of 311.88 g/mol. Its IUPAC name is 3-(3-chloro-6-ethoxy-2,4-dimethylphenyl)pentyl thiocyanate.
| Compound Name | 3-(3-chloro-6-ethoxy-2,4-dimethylphenyl)pentyl thiocyanate |
|---|---|
| PubChem CID | 112719172 |
| Molecular Formula | C16H22ClNOS |
| Molecular Weight | 311.88 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-(3-chloro-6-ethoxy-2,4-dimethylphenyl)pentyl thiocyanate |
| SMILES | CCOc1cc(C)c(Cl)c(C)c1C(CC)CCSC#N |
| InChI | InChI=1S/C16H22ClNOS/c1-5-13(7-8-20-10-18)15-12(4)16(17)11(3)9-14(15)19-6-2/h9,13H,5-8H2,1-4H3 |
| InChIKey | JLYDHECFJMIMDI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.88 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|