C16H23ClO3 — CID 83958661
3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)pentanoic acid (PubChem CID 83958661) has the molecular formula C16H23ClO3 and a molecular weight of 298.81 g/mol. Its IUPAC name is 3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)pentanoic acid.
| Compound Name | 3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 83958661 |
| Molecular Formula | C16H23ClO3 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)pentanoic acid |
| SMILES | CCCOc1cc(C)c(Cl)c(C)c1C(CC)CC(=O)O |
| InChI | InChI=1S/C16H23ClO3/c1-5-7-20-13-8-10(3)16(17)11(4)15(13)12(6-2)9-14(18)19/h8,12H,5-7,9H2,1-4H3,(H,18,19) |
| InChIKey | OTVBZFSPEXAYNZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |