(E)-3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)but-2-enoic acid

C15H19ClO3 — CID 83958664

IUPAC(E)-3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)but-2-enoic acid
SMILESCCCOc1cc(C)c(Cl)c(C)c1/C(C)=C/C(=O)O
InChIInChI=1S/C15H19ClO3/c1-5-6-19-12-7-10(3)15(16)11(4)14(12)9(2)8-13(17)18/h7-8H,5-6H2,1-4H3,(H,17,18)/b9-8+
InChIKeyMETZEJZEOMITRB-CMDGGOBGSA-N
MW282.77 g/mol
LogP4.23
Rot. Bonds5

About (E)-3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)but-2-enoic acid

(E)-3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)but-2-enoic acid (PubChem CID 83958664) has the molecular formula C15H19ClO3 and a molecular weight of 282.77 g/mol. Its IUPAC name is (E)-3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)but-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)but-2-enoic acid
PubChem CID83958664
Molecular FormulaC15H19ClO3
Molecular Weight282.77 g/mol
Exact Mass282.10
IUPAC Name(E)-3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)but-2-enoic acid
SMILESCCCOc1cc(C)c(Cl)c(C)c1/C(C)=C/C(=O)O
InChIInChI=1S/C15H19ClO3/c1-5-6-19-12-7-10(3)15(16)11(4)14(12)9(2)8-13(17)18/h7-8H,5-6H2,1-4H3,(H,17,18)/b9-8+
InChIKeyMETZEJZEOMITRB-CMDGGOBGSA-N
XLogP4.23
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.77
LogP ≤ 54.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)but-2-enoic acid?
The IUPAC name of (E)-3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)but-2-enoic acid (CID 83958664) is (E)-3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)but-2-enoic acid.
What is the SMILES notation for (E)-3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)but-2-enoic acid?
The canonical SMILES for (E)-3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)but-2-enoic acid is CCCOc1cc(C)c(Cl)c(C)c1/C(C)=C/C(=O)O.
What is the InChIKey of (E)-3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)but-2-enoic acid?
The InChIKey is METZEJZEOMITRB-CMDGGOBGSA-N. The full InChI is InChI=1S/C15H19ClO3/c1-5-6-19-12-7-10(3)15(16)11(4)14(12)9(2)8-13(17)18/h7-8H,5-6H2,1-4H3,(H,17,18)/b9-8+.
What are the key properties of (E)-3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)but-2-enoic acid?
(E)-3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)but-2-enoic acid has a molecular weight of 282.77 g/mol, XLogP of 4.23, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)but-2-enoic acid is sourced from PubChem (CID 83958664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).