C15H21ClO3 — CID 83958660
3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)butanoic acid (PubChem CID 83958660) has the molecular formula C15H21ClO3 and a molecular weight of 284.78 g/mol. Its IUPAC name is 3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)butanoic acid.
| Compound Name | 3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 83958660 |
| Molecular Formula | C15H21ClO3 |
| Molecular Weight | 284.78 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-(3-chloro-2,4-dimethyl-6-propoxyphenyl)butanoic acid |
| SMILES | CCCOc1cc(C)c(Cl)c(C)c1C(C)CC(=O)O |
| InChI | InChI=1S/C15H21ClO3/c1-5-6-19-12-7-10(3)15(16)11(4)14(12)9(2)8-13(17)18/h7,9H,5-6,8H2,1-4H3,(H,17,18) |
| InChIKey | YAKMHXUHMMFPIN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.78 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |