C16H23ClO2S — CID 82053373
1-(3-chloro-2,4-dimethyl-6-propoxyphenyl)-2-propylsulfanylethanone (PubChem CID 82053373) has the molecular formula C16H23ClO2S and a molecular weight of 314.88 g/mol. Its IUPAC name is 1-(3-chloro-2,4-dimethyl-6-propoxyphenyl)-2-propylsulfanylethanone.
| Compound Name | 1-(3-chloro-2,4-dimethyl-6-propoxyphenyl)-2-propylsulfanylethanone |
|---|---|
| PubChem CID | 82053373 |
| Molecular Formula | C16H23ClO2S |
| Molecular Weight | 314.88 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 1-(3-chloro-2,4-dimethyl-6-propoxyphenyl)-2-propylsulfanylethanone |
| SMILES | CCCOc1cc(C)c(Cl)c(C)c1C(=O)CSCCC |
| InChI | InChI=1S/C16H23ClO2S/c1-5-7-19-14-9-11(3)16(17)12(4)15(14)13(18)10-20-8-6-2/h9H,5-8,10H2,1-4H3 |
| InChIKey | WBZIRGIOVQRYNY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.88 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|