C19H32O3 — CID 83934527
4-(3-tert-butyl-4-propoxyphenyl)hexane-1,2-diol (PubChem CID 83934527) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 4-(3-tert-butyl-4-propoxyphenyl)hexane-1,2-diol.
| Compound Name | 4-(3-tert-butyl-4-propoxyphenyl)hexane-1,2-diol |
|---|---|
| PubChem CID | 83934527 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 4-(3-tert-butyl-4-propoxyphenyl)hexane-1,2-diol |
| SMILES | CCCOc1ccc(C(CC)CC(O)CO)cc1C(C)(C)C |
| InChI | InChI=1S/C19H32O3/c1-6-10-22-18-9-8-15(12-17(18)19(3,4)5)14(7-2)11-16(21)13-20/h8-9,12,14,16,20-21H,6-7,10-11,13H2,1-5H3 |
| InChIKey | UNQKIKWJJGRYDG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |